CAS 1218790-81-8 appears in our catalog under these names: 3-(3-(Ethoxycarbonyl)piperidine-1-carbonyl)phenylboronic acid, 96%, (3-(3-(Ethoxycarbonyl)piperidine-1-carbonyl)phenyl)boronic acid 96%, 3-(3-(ETHOXYCARBONYL)PIPERIDINE-1-CARBONYL)PHENYLBORONIC ACID, 96%, 96%, (3-(3-(Ethoxycarbonyl)piperidine-1-carbonyl)phenyl)boronic acid, 96%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 25g, 100g.
[3-(3-ethoxycarbonylpiperidine-1-carbonyl)phenyl]boronic acid (CAS 1218790-81-8) is a chemical compound with the molecular formula C15H20BNO5 and a molecular weight of 305.14 g/mol. IUPAC name: [3-(3-ethoxycarbonylpiperidine-1-carbonyl)phenyl]boronic acid. InChIKey: ADLXIBSCIGGNHP-UHFFFAOYSA-N.
| Molecular formula | C15H20BNO5 |
|---|---|
| Molecular weight | 305.14 g/mol |
| IUPAC name | [3-(3-ethoxycarbonylpiperidine-1-carbonyl)phenyl]boronic acid |
| InChIKey | ADLXIBSCIGGNHP-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C(=O)N2CCCC(C2)C(=O)OCC)(O)O |
Computed by PubChem (NCBI)