CAS 1218790-77-2 is the registry number for 3-Pyrrolidinophenylboronic acid hydrochloride, 97%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(3-pyrrolidin-1-ylphenyl)boronic acid;hydrochloride (CAS 1218790-77-2) is a chemical compound with the molecular formula C10H15BClNO2 and a molecular weight of 227.50 g/mol. IUPAC name: (3-pyrrolidin-1-ylphenyl)boronic acid;hydrochloride. InChIKey: DQOODNSQPNNSJY-UHFFFAOYSA-N.
| Molecular formula | C10H15BClNO2 |
|---|---|
| Molecular weight | 227.50 g/mol |
| IUPAC name | (3-pyrrolidin-1-ylphenyl)boronic acid;hydrochloride |
| InChIKey | DQOODNSQPNNSJY-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)N2CCCC2)(O)O.Cl |
Computed by PubChem (NCBI)