Products 1218790-77-2

CAS 1218790-77-2 is the registry number for 3-Pyrrolidinophenylboronic acid hydrochloride, 97%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

(3-pyrrolidin-1-ylphenyl)boronic acid;hydrochloride (CAS 1218790-77-2) is a chemical compound with the molecular formula C10H15BClNO2 and a molecular weight of 227.50 g/mol. IUPAC name: (3-pyrrolidin-1-ylphenyl)boronic acid;hydrochloride. InChIKey: DQOODNSQPNNSJY-UHFFFAOYSA-N.

Identity
Molecular formulaC10H15BClNO2
Molecular weight227.50 g/mol
IUPAC name(3-pyrrolidin-1-ylphenyl)boronic acid;hydrochloride
InChIKeyDQOODNSQPNNSJY-UHFFFAOYSA-N
SMILESB(C1=CC(=CC=C1)N2CCCC2)(O)O.Cl

Computed by PubChem (NCBI)