Products 1309982-59-9

CAS 1309982-59-9 is the registry number for 4-(Pyrrolidino)phenylboronic acid hydrochloride, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 10g, 5g.

Structural formula: {0} (CAS {1})

(4-pyrrolidin-1-ylphenyl)boronic acid;hydrochloride (CAS 1309982-59-9) is a chemical compound with the molecular formula C10H15BClNO2 and a molecular weight of 227.50 g/mol. IUPAC name: (4-pyrrolidin-1-ylphenyl)boronic acid;hydrochloride. InChIKey: OWKIWLOZIOTTEF-UHFFFAOYSA-N.

Identity
Molecular formulaC10H15BClNO2
Molecular weight227.50 g/mol
IUPAC name(4-pyrrolidin-1-ylphenyl)boronic acid;hydrochloride
InChIKeyOWKIWLOZIOTTEF-UHFFFAOYSA-N
SMILESB(C1=CC=C(C=C1)N2CCCC2)(O)O.Cl

Computed by PubChem (NCBI)