Products 1218790-98-7
CAS 1218790-98-7 appears in our catalog under these names: 4-(1-Carboxycyclopropyl)phenylboronic acid, pinacol ester, 96%, 1-(4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)cyclopropanecarboxylic acid, 98%, 4-(1-Carboxycyclopropyl)phenylboronic acid, pinacol ester, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 25g, 5g, 100mg, 250mg.
1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclopropane-1-carboxylic acid (CAS 1218790-98-7) is a chemical compound with the molecular formula C16H21BO4 and a molecular weight of 288.1 g/mol. IUPAC name: 1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclopropane-1-carboxylic acid. InChIKey: YZWDIFNCAKRQCL-UHFFFAOYSA-N.
| Molecular formula | C16H21BO4 |
|---|---|
| Molecular weight | 288.1 g/mol |
| IUPAC name | 1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclopropane-1-carboxylic acid |
| InChIKey | YZWDIFNCAKRQCL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C3(CC3)C(=O)O |
Computed by PubChem (NCBI)