Products 2409141-59-7
CAS 2409141-59-7 is the registry number for Methyl (E)-3-(2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)vinyl)benzoate, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
Methyl 3-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]benzoate (CAS 2409141-59-7) is a chemical compound with the molecular formula C16H21BO4 and a molecular weight of 288.1 g/mol. IUPAC name: methyl 3-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]benzoate. InChIKey: FKXCEOGWCSWZGQ-MDZDMXLPSA-N.
| Molecular formula | C16H21BO4 |
|---|---|
| Molecular weight | 288.1 g/mol |
| IUPAC name | methyl 3-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]benzoate |
| InChIKey | FKXCEOGWCSWZGQ-MDZDMXLPSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C=C/C2=CC(=CC=C2)C(=O)OC |
Computed by PubChem (NCBI)