CAS 1218790-99-8 appears in our catalog under these names: Piperidine-4-boronic acid pinacol ester hydrochloride, 96%, 4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)piperidine hydrochloride 98%, PIPERIDINE-4-BORONIC ACID PINACOL ESTER&, piperidine-4-boronic acid pinacol ester HCl, 98%, 98%, 4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)piperidine hydrochloride, 95%. Offered by: Combi-blocks, Ambeed, Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 5g, 100mg, 250mg.
4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)piperidine;hydrochloride (CAS 1218790-99-8) is a chemical compound with the molecular formula C11H23BClNO2 and a molecular weight of 247.57 g/mol. IUPAC name: 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)piperidine;hydrochloride. InChIKey: DJEBJGUAIJWKGA-UHFFFAOYSA-N.
| Molecular formula | C11H23BClNO2 |
|---|---|
| Molecular weight | 247.57 g/mol |
| IUPAC name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)piperidine;hydrochloride |
| InChIKey | DJEBJGUAIJWKGA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2CCNCC2.Cl |
Computed by PubChem (NCBI)