CAS 811439-31-3 is the registry number for 2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)piperidine Hydrochloride. Offered by: TRC. Available pack sizes: 250mg.
2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)piperidine;hydrochloride (CAS 811439-31-3) is a chemical compound with the molecular formula C11H23BClNO2 and a molecular weight of 247.57 g/mol. IUPAC name: 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)piperidine;hydrochloride. InChIKey: LWESFUOWZXRQKR-UHFFFAOYSA-N.
| Molecular formula | C11H23BClNO2 |
|---|---|
| Molecular weight | 247.57 g/mol |
| IUPAC name | 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)piperidine;hydrochloride |
| InChIKey | LWESFUOWZXRQKR-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2CCCCN2.Cl |
Computed by PubChem (NCBI)