Products 1218791-17-3

CAS 1218791-17-3 is the registry number for 1-Methylpyrrole-2,5-diboronoic acid, pinacol ester, 96%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

1-methyl-2,5-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrole (CAS 1218791-17-3) is a chemical compound with the molecular formula C17H29B2NO4 and a molecular weight of 333.0 g/mol. IUPAC name: 1-methyl-2,5-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrole. InChIKey: OCVGYKJQPDKDJK-UHFFFAOYSA-N.

Identity
Molecular formulaC17H29B2NO4
Molecular weight333.0 g/mol
IUPAC name1-methyl-2,5-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrole
InChIKeyOCVGYKJQPDKDJK-UHFFFAOYSA-N
SMILESB1(OC(C(O1)(C)C)(C)C)C2=CC=C(N2C)B3OC(C(O3)(C)C)(C)C

Computed by PubChem (NCBI)