CAS 1278579-60-4 is the registry number for 1-Methyl-1H-pyrrole-2,4-diboronic acid, pinacol ester, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1-methyl-2,4-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrole (CAS 1278579-60-4) is a chemical compound with the molecular formula C17H29B2NO4 and a molecular weight of 333.0 g/mol. IUPAC name: 1-methyl-2,4-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrole. InChIKey: IJBHSWGFCDPVPD-UHFFFAOYSA-N.
| Molecular formula | C17H29B2NO4 |
|---|---|
| Molecular weight | 333.0 g/mol |
| IUPAC name | 1-methyl-2,4-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrole |
| InChIKey | IJBHSWGFCDPVPD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CN2C)B3OC(C(O3)(C)C)(C)C |
Computed by PubChem (NCBI)