CAS 1218791-30-0 is the registry number for 3-(Isopropoxycarbonyl)-5-methylphenylboronic acid, pinacol ester, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Propan-2-yl 3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS 1218791-30-0) is a chemical compound with the molecular formula C17H25BO4 and a molecular weight of 304.2 g/mol. IUPAC name: propan-2-yl 3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. InChIKey: IJZINCHSUOKFFX-UHFFFAOYSA-N.
| Molecular formula | C17H25BO4 |
|---|---|
| Molecular weight | 304.2 g/mol |
| IUPAC name | propan-2-yl 3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| InChIKey | IJZINCHSUOKFFX-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)C(=O)OC(C)C)C |
Computed by PubChem (NCBI)