CAS 2121511-54-2 appears in our catalog under these names: 2-Ethoxycarbonyl-5-ethylphenylboronic acid pinacol ester, 95%, 2-Ethoxycarbonyl-5-ethylphenylboronic acid pinacol ester, ≥95%, 2-Ethoxycarbonyl-5-ethylphenylboronic acid pinacol ester, ≥95%, ≥95%. Offered by: Combi-blocks, Fluorochem, Chemat. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
Ethyl 4-ethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS 2121511-54-2) is a chemical compound with the molecular formula C17H25BO4 and a molecular weight of 304.2 g/mol. IUPAC name: ethyl 4-ethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. InChIKey: QALXENSAFBZBKZ-UHFFFAOYSA-N.
| Molecular formula | C17H25BO4 |
|---|---|
| Molecular weight | 304.2 g/mol |
| IUPAC name | ethyl 4-ethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| InChIKey | QALXENSAFBZBKZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)CC)C(=O)OCC |
Computed by PubChem (NCBI)