CAS 1218791-35-5 is the registry number for 3-Cyano-2-ethoxypyridine-5-boronic acid, pinacol ester, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-ethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carbonitrile (CAS 1218791-35-5) is a chemical compound with the molecular formula C14H19BN2O3 and a molecular weight of 274.13 g/mol. IUPAC name: 2-ethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carbonitrile. InChIKey: PFKXCMXVFNDOFO-UHFFFAOYSA-N.
| Molecular formula | C14H19BN2O3 |
|---|---|
| Molecular weight | 274.13 g/mol |
| IUPAC name | 2-ethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carbonitrile |
| InChIKey | PFKXCMXVFNDOFO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(N=C2)OCC)C#N |
Computed by PubChem (NCBI)