CAS 2098426-72-1 is the registry number for 2-Methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-dihydro-3H-indazol-3-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazol-3-one (CAS 2098426-72-1) is a chemical compound with the molecular formula C14H19BN2O3 and a molecular weight of 274.13 g/mol. IUPAC name: 2-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazol-3-one. InChIKey: NZZSEUGVMPZTMW-UHFFFAOYSA-N.
| Molecular formula | C14H19BN2O3 |
|---|---|
| Molecular weight | 274.13 g/mol |
| IUPAC name | 2-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazol-3-one |
| InChIKey | NZZSEUGVMPZTMW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)C(=O)N(N3)C |
Computed by PubChem (NCBI)