Products 1218932-97-8
CAS 1218932-97-8 is the registry number for 5-InoAz. Offered by: MedChemExpress. Available pack sizes: Get quote.
(1S,2R,4S,5R)-6-azidocyclohexane-1,2,3,4,5-pentol (CAS 1218932-97-8) is a chemical compound with the molecular formula C6H11N3O5 and a molecular weight of 205.17 g/mol. IUPAC name: (1S,2R,4S,5R)-6-azidocyclohexane-1,2,3,4,5-pentol. InChIKey: KTRSBMDLCXWFCL-UYSNGIAKSA-N.
| Molecular formula | C6H11N3O5 |
|---|---|
| Molecular weight | 205.17 g/mol |
| IUPAC name | (1S,2R,4S,5R)-6-azidocyclohexane-1,2,3,4,5-pentol |
| InChIKey | KTRSBMDLCXWFCL-UYSNGIAKSA-N |
| SMILES | [C@H]1([C@H](C([C@H]([C@@H](C1N=[N+]=[N-])O)O)O)O)O |
Computed by PubChem (NCBI)