CAS 51970-29-7 appears in our catalog under these names: alpha-D-Mannopyranosyl azide, α-D-Mannopyranosyl azide. Offered by: Chemat, Biosynth. Available pack sizes: 100mg, 1g, 250mg, 500mg, 50mg, 25mg, 10mg.
(2S,3S,4S,5S,6R)-2-azido-6-(hydroxymethyl)oxane-3,4,5-triol (CAS 51970-29-7) is a chemical compound with the molecular formula C6H11N3O5 and a molecular weight of 205.17 g/mol. IUPAC name: (2S,3S,4S,5S,6R)-2-azido-6-(hydroxymethyl)oxane-3,4,5-triol. InChIKey: KSRDTSABQYNYMP-PQMKYFCFSA-N.
| Molecular formula | C6H11N3O5 |
|---|---|
| Molecular weight | 205.17 g/mol |
| IUPAC name | (2S,3S,4S,5S,6R)-2-azido-6-(hydroxymethyl)oxane-3,4,5-triol |
| InChIKey | KSRDTSABQYNYMP-PQMKYFCFSA-N |
| SMILES | C([C@@H]1[C@H]([C@@H]([C@@H]([C@H](O1)N=[N+]=[N-])O)O)O)O |
Computed by PubChem (NCBI)