CAS 1218993-03-3 appears in our catalog under these names: (2-Cyano-3-fluorophenyl)boronic acid 95+%, (2-Cyano-3-fluorophenyl)boronic acid, 95+%, (2-Cyano-3-fluorophenyl)boronic acid, 95+%, 95+%. Offered by: Ambeed, Fluorochem, Chemat. Available pack sizes: 250mg, 1g, 5g.
(2-cyano-3-fluorophenyl)boronic acid (CAS 1218993-03-3) is a chemical compound with the molecular formula C7H5BFNO2 and a molecular weight of 164.93 g/mol. IUPAC name: (2-cyano-3-fluorophenyl)boronic acid. InChIKey: SJGAIKIHINNTDX-UHFFFAOYSA-N.
| Molecular formula | C7H5BFNO2 |
|---|---|
| Molecular weight | 164.93 g/mol |
| IUPAC name | (2-cyano-3-fluorophenyl)boronic acid |
| InChIKey | SJGAIKIHINNTDX-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)F)C#N)(O)O |
Computed by PubChem (NCBI)