Products 468718-30-1

CAS 468718-30-1 appears in our catalog under these names: 5–Cyano–2–fluorophenylboronic acid, 5-Cyano-2-fluorophenylboronic Acid (contains varying amounts of Anhydride), 5-Cyano-2-fluorobenzeneboronic acid 97%, 5-Cyano-2-fluorobenzeneboronic acid, 97%, 97%, 5-Cyano-2-fluorobenzeneboronic acid, 95%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g, 25g, 100g.

Structural formula: {0} (CAS {1})

(5-cyano-2-fluorophenyl)boronic acid (CAS 468718-30-1) is a chemical compound with the molecular formula C7H5BFNO2 and a molecular weight of 164.93 g/mol. IUPAC name: (5-cyano-2-fluorophenyl)boronic acid. InChIKey: ITCSMTHUTFTXLE-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5BFNO2
Molecular weight164.93 g/mol
IUPAC name(5-cyano-2-fluorophenyl)boronic acid
InChIKeyITCSMTHUTFTXLE-UHFFFAOYSA-N
SMILESB(C1=C(C=CC(=C1)C#N)F)(O)O

Computed by PubChem (NCBI)