Products 1219038-31-9

CAS 1219038-31-9 appears in our catalog under these names: (9Z,12Z)-9,12-Octadecadien-17-ynoic Acid, Linoleic Acid Alkyne, Linoleic acid alkyne, 96.1%. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 50mg, 1mg, 100μg, 5mg, 500μg, 100 μg (3.62 mM * 100 μL in Ethanol).

Structural formula: {0} (CAS {1})

(9Z,12Z)-octadeca-9,12-dien-17-ynoic acid (CAS 1219038-31-9) is a chemical compound with the molecular formula C18H28O2 and a molecular weight of 276.4 g/mol. IUPAC name: (9Z,12Z)-octadeca-9,12-dien-17-ynoic acid. InChIKey: WPOFIMJJIQUNRW-HZJYTTRNSA-N.

Identity
Molecular formulaC18H28O2
Molecular weight276.4 g/mol
IUPAC name(9Z,12Z)-octadeca-9,12-dien-17-ynoic acid
InChIKeyWPOFIMJJIQUNRW-HZJYTTRNSA-N
SMILESC#CCCC/C=C\C/C=C\CCCCCCCC(=O)O

Computed by PubChem (NCBI)