CAS 121905-60-0 appears in our catalog under these names: m–Tolylmagnesium chloride, m-Tolylmagnesium chloride, 1M solution in THF, AcroSeal®. Offered by: GLPBio, Thermo Scientific (Acros). Available pack sizes: 100ml.
Magnesium;methylbenzene;chloride (CAS 121905-60-0) is a chemical compound with the molecular formula C7H7ClMg and a molecular weight of 150.89 g/mol. IUPAC name: magnesium;methylbenzene;chloride. InChIKey: YIDAONIIDXWYSC-UHFFFAOYSA-M.
| Molecular formula | C7H7ClMg |
|---|---|
| Molecular weight | 150.89 g/mol |
| IUPAC name | magnesium;methylbenzene;chloride |
| InChIKey | YIDAONIIDXWYSC-UHFFFAOYSA-M |
| SMILES | CC1=CC=C[C-]=C1.[Mg+2].[Cl-] |
Computed by PubChem (NCBI)