CAS 33872-80-9 appears in our catalog under these names: o–Tolylmagnesium chloride, 2-Tolylmagnesium chloride 1M solution in THF, O-TOLYLMAGNESIUM CHLORIDE, 1.0M SOLUTIO&. Offered by: GLPBio, Biosynth, Sigma-Aldrich. Available pack sizes: 100ml, 1l, 500ml, 5000ml, 800ML.
Magnesium;methylbenzene;chloride (CAS 33872-80-9) is a chemical compound with the molecular formula C7H7ClMg and a molecular weight of 150.89 g/mol. IUPAC name: magnesium;methylbenzene;chloride. InChIKey: LQVSLLSEXLZRRH-UHFFFAOYSA-M.
| Molecular formula | C7H7ClMg |
|---|---|
| Molecular weight | 150.89 g/mol |
| IUPAC name | magnesium;methylbenzene;chloride |
| InChIKey | LQVSLLSEXLZRRH-UHFFFAOYSA-M |
| SMILES | CC1=CC=CC=[C-]1.[Mg+2].[Cl-] |
Computed by PubChem (NCBI)