CAS 1219112-85-2 appears in our catalog under these names: 1-(2-Bromo-6-chlorophenyl)indolin-2-one, 1-(2-Bromo-6-chlorophenyl)-1,3-dihydro-2H-indol-2-one, Diclofenac Impurity O. Offered by: Mikromol, TRC, Chemat Brand. Available pack sizes: 25mg, 100mg, on request.
1-(2-bromo-6-chlorophenyl)-3H-indol-2-one (CAS 1219112-85-2) is a chemical compound with the molecular formula C14H9BrClNO and a molecular weight of 322.58 g/mol. IUPAC name: 1-(2-bromo-6-chlorophenyl)-3H-indol-2-one. InChIKey: CMBSFZZHGLVIPB-UHFFFAOYSA-N.
| Molecular formula | C14H9BrClNO |
|---|---|
| Molecular weight | 322.58 g/mol |
| IUPAC name | 1-(2-bromo-6-chlorophenyl)-3H-indol-2-one |
| InChIKey | CMBSFZZHGLVIPB-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2N(C1=O)C3=C(C=CC=C3Br)Cl |
Computed by PubChem (NCBI)