CAS 156073-28-8 is the registry number for 3-Bromo-8-chloro-5H-benzo[5,6]cyclohepta[1,2-b]pyridin-11(6H)-one, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
6-bromo-13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-one (CAS 156073-28-8) is a chemical compound with the molecular formula C14H9BrClNO and a molecular weight of 322.58 g/mol. IUPAC name: 6-bromo-13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-one. InChIKey: CSUZZEVXBPNANR-UHFFFAOYSA-N.
| Molecular formula | C14H9BrClNO |
|---|---|
| Molecular weight | 322.58 g/mol |
| IUPAC name | 6-bromo-13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-one |
| InChIKey | CSUZZEVXBPNANR-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=O)C3=C1C=C(C=C3)Cl)N=CC(=C2)Br |
Computed by PubChem (NCBI)