CAS 1219125-53-7 is the registry number for Miglitol Impurity 8. Offered by: Chemat Brand. Available pack sizes: on request.
(3R,4R,5R)-1-(2-hydroxyethyl)-2-(hydroxymethyl)piperidine-3,4,5-triol (CAS 1219125-53-7) is a chemical compound with the molecular formula C8H17NO5 and a molecular weight of 207.22 g/mol. IUPAC name: (3R,4R,5R)-1-(2-hydroxyethyl)-2-(hydroxymethyl)piperidine-3,4,5-triol. InChIKey: IBAQFPQHRJAVAV-UIYHXYAWSA-N.
| Molecular formula | C8H17NO5 |
|---|---|
| Molecular weight | 207.22 g/mol |
| IUPAC name | (3R,4R,5R)-1-(2-hydroxyethyl)-2-(hydroxymethyl)piperidine-3,4,5-triol |
| InChIKey | IBAQFPQHRJAVAV-UIYHXYAWSA-N |
| SMILES | C1[C@H]([C@H]([C@@H](C(N1CCO)CO)O)O)O |
Computed by PubChem (NCBI)