CAS 132310-34-0 is the registry number for Galacto Miglitol. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,3S,4R,5S)-1-(2-hydroxyethyl)-2-(hydroxymethyl)piperidine-3,4,5-triol (CAS 132310-34-0) is a chemical compound with the molecular formula C8H17NO5 and a molecular weight of 207.22 g/mol. IUPAC name: (2R,3S,4R,5S)-1-(2-hydroxyethyl)-2-(hydroxymethyl)piperidine-3,4,5-triol. InChIKey: IBAQFPQHRJAVAV-VGRMVHKJSA-N.
| Molecular formula | C8H17NO5 |
|---|---|
| Molecular weight | 207.22 g/mol |
| IUPAC name | (2R,3S,4R,5S)-1-(2-hydroxyethyl)-2-(hydroxymethyl)piperidine-3,4,5-triol |
| InChIKey | IBAQFPQHRJAVAV-VGRMVHKJSA-N |
| SMILES | C1[C@@H]([C@H]([C@H]([C@H](N1CCO)CO)O)O)O |
Computed by PubChem (NCBI)