CAS 1246496-54-7 is the registry number for 1,4-Bis((1S)-1-(4-methoxyphenyl)ethyl)-2,5-piperazinedione-d4. Offered by: TRC. Available pack sizes: 10mg, 25mg, 50mg.
(2R)-1-(3-amino-4-hydroxyoxan-2-yl)propane-1,2,3-triol (CAS 1246496-54-7) is a chemical compound with the molecular formula C8H17NO5 and a molecular weight of 207.22 g/mol. IUPAC name: (2R)-1-(3-amino-4-hydroxyoxan-2-yl)propane-1,2,3-triol. InChIKey: OFVAPPDNLHBFTC-UYVALTIASA-N.
| Molecular formula | C8H17NO5 |
|---|---|
| Molecular weight | 207.22 g/mol |
| IUPAC name | (2R)-1-(3-amino-4-hydroxyoxan-2-yl)propane-1,2,3-triol |
| InChIKey | OFVAPPDNLHBFTC-UYVALTIASA-N |
| SMILES | C1COC(C(C1O)N)C([C@@H](CO)O)O |
Computed by PubChem (NCBI)