Products 1219184-45-8

CAS 1219184-45-8 is the registry number for Fmoc-DL-Nle(Me)-OH 98%. Offered by: Ambeed. Available pack sizes: 250mg, 1g, 5g, 25g, 100g.

Structural formula: {0} (CAS {1})

2-(9H-fluoren-9-ylmethoxycarbonylamino)heptanoic acid (CAS 1219184-45-8) is a chemical compound with the molecular formula C22H25NO4 and a molecular weight of 367.4 g/mol. IUPAC name: 2-(9H-fluoren-9-ylmethoxycarbonylamino)heptanoic acid. InChIKey: DSEDZIUESKRBOW-UHFFFAOYSA-N.

Identity
Molecular formulaC22H25NO4
Molecular weight367.4 g/mol
IUPAC name2-(9H-fluoren-9-ylmethoxycarbonylamino)heptanoic acid
InChIKeyDSEDZIUESKRBOW-UHFFFAOYSA-N
SMILESCCCCCC(C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13

Computed by PubChem (NCBI)