Products 1219257-11-0
CAS 1219257-11-0 appears in our catalog under these names: Chlorocholine Chloride-d9, >95% (HPLC), Chlormequat-d9 Chloride (N,N,N-trimethyl-d9), 99 atom % D, min 98% Chemical Purity, Chlorocholine-d9 (chloride), D9-Chlormequat chloride, D9-Chlormequat chloride, Concentration: 100 µg/ml Solvent: Deuterium oxide. Offered by: TRC, CDN, MedChemExpress, HPC Standards. Available pack sizes: 50mg, 5mg, 0,05g, 0,01g, 5 mg, 50 mg, 1x5mg, 1x10ml.
2-chloroethyl-tris(trideuteriomethyl)azanium chloride (CAS 1219257-11-0) is a chemical compound with the molecular formula C5H13Cl2N and a molecular weight of 167.12 g/mol. IUPAC name: 2-chloroethyl-tris(trideuteriomethyl)azanium chloride. InChIKey: UHZZMRAGKVHANO-KYRNGWDOSA-M.
| Molecular formula | C5H13Cl2N |
|---|---|
| Molecular weight | 167.12 g/mol |
| IUPAC name | 2-chloroethyl-tris(trideuteriomethyl)azanium chloride |
| InChIKey | UHZZMRAGKVHANO-KYRNGWDOSA-M |
| SMILES | [2H]C([2H])([2H])[N+](CCCl)(C([2H])([2H])[2H])C([2H])([2H])[2H].[Cl-] |
Computed by PubChem (NCBI)
Synonyms:
Chlorocholine Chloride-d9, 2-chloroethyl-tris(trideuteriomethyl)azanium;chloride, Chlorocholine-d9 (chloride), Chlormequat-d9 Chloride (N,N,N-trimethyl-d9), Chlorocholine-d9 chloride, Chlormequat chloride-d9, (2-Chloroethyl)trimethyl-d9-ammonium chloride, 98 atom % D, 2-Chloro-N,N,N-tris[(~2~H_3_)methyl]ethan-1-aminium chloride