CAS 1219799-04-8 appears in our catalog under these names: 3-Chloro-N,N-dimethyl-d6-propylamine HCl, 98 atom % D, min 98% Chemical Purity, 3-Chloro-N,N-dimethylpropan-1-amine-d6 (hydrochloride), 99%. Offered by: CDN, MedChemExpress. Available pack sizes: 0,25g, 0,1g, 5 mg, 1 mg, 25 mg, 10 mg.
3-chloro-N,N-bis(trideuteriomethyl)propan-1-amine;hydrochloride (CAS 1219799-04-8) is a chemical compound with the molecular formula C5H13Cl2N and a molecular weight of 164.10 g/mol. IUPAC name: 3-chloro-N,N-bis(trideuteriomethyl)propan-1-amine;hydrochloride. InChIKey: LJQNMDZRCXJETK-TXHXQZCNSA-N.
| Molecular formula | C5H13Cl2N |
|---|---|
| Molecular weight | 164.10 g/mol |
| IUPAC name | 3-chloro-N,N-bis(trideuteriomethyl)propan-1-amine;hydrochloride |
| InChIKey | LJQNMDZRCXJETK-TXHXQZCNSA-N |
| SMILES | [2H]C([2H])([2H])N(CCCCl)C([2H])([2H])[2H].Cl |
Computed by PubChem (NCBI)