CAS 1219349-78-6 is the registry number for rac Fmoc-trifluoromethylalanine. Offered by: Biosynth. Available pack sizes: 0,25g.
2-(9H-fluoren-9-ylmethoxycarbonylamino)-3,3,3-trifluoropropanoic acid (CAS 1219349-78-6) is a chemical compound with the molecular formula C18H14F3NO4 and a molecular weight of 365.3 g/mol. IUPAC name: 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3,3,3-trifluoropropanoic acid. InChIKey: GSEIXNCKLHONCZ-UHFFFAOYSA-N.
| Molecular formula | C18H14F3NO4 |
|---|---|
| Molecular weight | 365.3 g/mol |
| IUPAC name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3,3,3-trifluoropropanoic acid |
| InChIKey | GSEIXNCKLHONCZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC(C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)