CAS 2349382-66-5 is the registry number for (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3,3,3-trifluoropropanoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3,3,3-trifluoropropanoic acid (CAS 2349382-66-5) is a chemical compound with the molecular formula C18H14F3NO4 and a molecular weight of 365.3 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3,3,3-trifluoropropanoic acid. InChIKey: GSEIXNCKLHONCZ-HNNXBMFYSA-N.
| Molecular formula | C18H14F3NO4 |
|---|---|
| Molecular weight | 365.3 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3,3,3-trifluoropropanoic acid |
| InChIKey | GSEIXNCKLHONCZ-HNNXBMFYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)