CAS 1219410-27-1 is the registry number for Boc-DL-selenomethionine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylselanylbutanoic acid (CAS 1219410-27-1) is a chemical compound with the molecular formula C10H19NO4Se and a molecular weight of 296.23 g/mol. IUPAC name: 2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylselanylbutanoic acid. InChIKey: QJDWZRHRGRTJOH-UHFFFAOYSA-N.
| Molecular formula | C10H19NO4Se |
|---|---|
| Molecular weight | 296.23 g/mol |
| IUPAC name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylselanylbutanoic acid |
| InChIKey | QJDWZRHRGRTJOH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CC[Se]C)C(=O)O |
Computed by PubChem (NCBI)