CAS 45172-44-9 is the registry number for Boc-L-Selenomethionine 98%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylselanylbutanoic acid (CAS 45172-44-9) is a chemical compound with the molecular formula C10H19NO4Se and a molecular weight of 296.23 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylselanylbutanoic acid. InChIKey: QJDWZRHRGRTJOH-ZETCQYMHSA-N.
| Molecular formula | C10H19NO4Se |
|---|---|
| Molecular weight | 296.23 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylselanylbutanoic acid |
| InChIKey | QJDWZRHRGRTJOH-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC[Se]C)C(=O)O |
Computed by PubChem (NCBI)