Products 1219634-35-1
CAS 1219634-35-1 is the registry number for 6,12-Dihydroindeno[1,2-b]fluorene-2,8-dithiol, 95%, 95%. Offered by: Chemat. Available pack sizes: 25mg, 50mg, 100mg.
6,12-dihydroindeno[1,2-b]fluorene-2,8-dithiol (CAS 1219634-35-1) is a chemical compound with the molecular formula C20H14S2 and a molecular weight of 318.5 g/mol. IUPAC name: 6,12-dihydroindeno[1,2-b]fluorene-2,8-dithiol. InChIKey: YCJZYJCNTUXCHI-UHFFFAOYSA-N.
| Molecular formula | C20H14S2 |
|---|---|
| Molecular weight | 318.5 g/mol |
| IUPAC name | 6,12-dihydroindeno[1,2-b]fluorene-2,8-dithiol |
| InChIKey | YCJZYJCNTUXCHI-UHFFFAOYSA-N |
| SMILES | C1C2=CC3=C(CC4=C3C=CC(=C4)S)C=C2C5=C1C=C(C=C5)S |
Computed by PubChem (NCBI)