CAS 124414-37-5 is the registry number for (1R)-[1,1'-Binaphthalene]-2,2'-dithiol 98%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
1-(2-sulfanylnaphthalen-1-yl)naphthalene-2-thiol (CAS 124414-37-5) is a chemical compound with the molecular formula C20H14S2 and a molecular weight of 318.5 g/mol. IUPAC name: 1-(2-sulfanylnaphthalen-1-yl)naphthalene-2-thiol. InChIKey: PQTIXYILPGIIHM-UHFFFAOYSA-N.
| Molecular formula | C20H14S2 |
|---|---|
| Molecular weight | 318.5 g/mol |
| IUPAC name | 1-(2-sulfanylnaphthalen-1-yl)naphthalene-2-thiol |
| InChIKey | PQTIXYILPGIIHM-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=C2C3=C(C=CC4=CC=CC=C43)S)S |
Computed by PubChem (NCBI)