Products 1219637-79-2
CAS 1219637-79-2 is the registry number for 5-Methoxy-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole, 95%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 250mg, 1g, 5g, 100mg.
5-methoxy-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole (CAS 1219637-79-2) is a chemical compound with the molecular formula C15H20BNO3 and a molecular weight of 273.14 g/mol. IUPAC name: 5-methoxy-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole. InChIKey: HXDLIEHKTHDXQH-UHFFFAOYSA-N.
| Molecular formula | C15H20BNO3 |
|---|---|
| Molecular weight | 273.14 g/mol |
| IUPAC name | 5-methoxy-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole |
| InChIKey | HXDLIEHKTHDXQH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC3=C2NC=C3)OC |
Computed by PubChem (NCBI)