Products 1219692-43-9
CAS 1219692-43-9 is the registry number for Descarbosy Ranelic Acid. Offered by: TRC. Available pack sizes: 100mg.
2-[5-[bis(carboxymethyl)amino]-4-cyanothiophen-3-yl]acetic acid (CAS 1219692-43-9) is a chemical compound with the molecular formula C11H10N2O6S and a molecular weight of 298.27 g/mol. IUPAC name: 2-[5-[bis(carboxymethyl)amino]-4-cyanothiophen-3-yl]acetic acid. InChIKey: DTOITDBQDACPAT-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O6S |
|---|---|
| Molecular weight | 298.27 g/mol |
| IUPAC name | 2-[5-[bis(carboxymethyl)amino]-4-cyanothiophen-3-yl]acetic acid |
| InChIKey | DTOITDBQDACPAT-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(S1)N(CC(=O)O)CC(=O)O)C#N)CC(=O)O |
Computed by PubChem (NCBI)