CAS 436096-98-9 is the registry number for 3-(2,3-Dioxo-1,2,3,4-tetrahydro-quinoxaline-6-sulfonyl)-propionic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
3-[(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)sulfonyl]propanoic acid (CAS 436096-98-9) is a chemical compound with the molecular formula C11H10N2O6S and a molecular weight of 298.27 g/mol. IUPAC name: 3-[(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)sulfonyl]propanoic acid. InChIKey: OZVDBHVMLBWBKC-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O6S |
|---|---|
| Molecular weight | 298.27 g/mol |
| IUPAC name | 3-[(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)sulfonyl]propanoic acid |
| InChIKey | OZVDBHVMLBWBKC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1S(=O)(=O)CCC(=O)O)NC(=O)C(=O)N2 |
Computed by PubChem (NCBI)