CAS 1219739-36-2 appears in our catalog under these names: AMPK Activator 991, >95% (HPLC), EX229/ 99.36% (existing batch purity), EX229, AMPK Activator 991, EX229 98%. Offered by: TRC, TargetMol, GLPBio, Biosynth, Ambeed. Available pack sizes: 10mg, 1mg, 5mg, 2mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso).
5-[[6-chloro-5-(1-methylindol-5-yl)-1H-benzimidazol-2-yl]oxy]-2-methylbenzoic acid (CAS 1219739-36-2) is a chemical compound with the molecular formula C24H18ClN3O3 and a molecular weight of 431.9 g/mol. IUPAC name: 5-[[6-chloro-5-(1-methylindol-5-yl)-1H-benzimidazol-2-yl]oxy]-2-methylbenzoic acid. InChIKey: FHWSAZXFPUMKFL-UHFFFAOYSA-N.
| Molecular formula | C24H18ClN3O3 |
|---|---|
| Molecular weight | 431.9 g/mol |
| IUPAC name | 5-[[6-chloro-5-(1-methylindol-5-yl)-1H-benzimidazol-2-yl]oxy]-2-methylbenzoic acid |
| InChIKey | FHWSAZXFPUMKFL-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)OC2=NC3=C(N2)C=C(C(=C3)C4=CC5=C(C=C4)N(C=C5)C)Cl)C(=O)O |
Computed by PubChem (NCBI)