Products 1219739-95-3
CAS 1219739-95-3 appears in our catalog under these names: AMPK–IN–1, AMPK-IN-1, 99.91%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 25 mg, 50 mg, 5 mg, 100 mg, 10 mg.
5-[[6-chloro-5-(1-methylindol-6-yl)-1H-benzimidazol-2-yl]oxy]-2-methylbenzoic acid (CAS 1219739-95-3) is a chemical compound with the molecular formula C24H18ClN3O3 and a molecular weight of 431.9 g/mol. IUPAC name: 5-[[6-chloro-5-(1-methylindol-6-yl)-1H-benzimidazol-2-yl]oxy]-2-methylbenzoic acid. InChIKey: ZPCGOSPLONPSIC-UHFFFAOYSA-N.
| Molecular formula | C24H18ClN3O3 |
|---|---|
| Molecular weight | 431.9 g/mol |
| IUPAC name | 5-[[6-chloro-5-(1-methylindol-6-yl)-1H-benzimidazol-2-yl]oxy]-2-methylbenzoic acid |
| InChIKey | ZPCGOSPLONPSIC-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)OC2=NC3=C(N2)C=C(C(=C3)C4=CC5=C(C=C4)C=CN5C)Cl)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
AMPK activator 991, orb1744345