Products 1219794-75-8
CAS 1219794-75-8 appears in our catalog under these names: 4-n-Butylaniline-2,3,5,6-d4,ND2, 98 atom % D, min 98% Chemical Purity, 4-Butylaniline-d6. Offered by: CDN, MedChemExpress. Available pack sizes: 0,1g, 1 mg.
4-butyl-N,N,2,3,5,6-hexadeuterioaniline (CAS 1219794-75-8) is a chemical compound with the molecular formula C10H15N and a molecular weight of 155.27 g/mol. IUPAC name: 4-butyl-N,N,2,3,5,6-hexadeuterioaniline. InChIKey: OGIQUQKNJJTLSZ-JKSPZENDSA-N.
| Molecular formula | C10H15N |
|---|---|
| Molecular weight | 155.27 g/mol |
| IUPAC name | 4-butyl-N,N,2,3,5,6-hexadeuterioaniline |
| InChIKey | OGIQUQKNJJTLSZ-JKSPZENDSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1CCCC)[2H])[2H])N([2H])[2H])[2H] |
Computed by PubChem (NCBI)