CAS 1219794-89-4 appears in our catalog under these names: 4-Butylaniline-d15, 4-n-Butylaniline-d15, 98 atom % D, min 98% Chemical Purity. Offered by: MedChemExpress, CDN. Available pack sizes: 1 mg, 0,1g, 0,05g.
N,N,2,3,5,6-hexadeuterio-4-(1,1,2,2,3,3,4,4,4-nonadeuteriobutyl)aniline (CAS 1219794-89-4) is a chemical compound with the molecular formula C10H15N and a molecular weight of 164.32 g/mol. IUPAC name: N,N,2,3,5,6-hexadeuterio-4-(1,1,2,2,3,3,4,4,4-nonadeuteriobutyl)aniline. InChIKey: OGIQUQKNJJTLSZ-RRFMZHHTSA-N.
| Molecular formula | C10H15N |
|---|---|
| Molecular weight | 164.32 g/mol |
| IUPAC name | N,N,2,3,5,6-hexadeuterio-4-(1,1,2,2,3,3,4,4,4-nonadeuteriobutyl)aniline |
| InChIKey | OGIQUQKNJJTLSZ-RRFMZHHTSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H])[2H])[2H])N([2H])[2H])[2H] |
Computed by PubChem (NCBI)