Products 1219794-84-9
CAS 1219794-84-9 is the registry number for n-Butyl-1,1,2,2,3,3-d6 Alcohol, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,25g, 0,1g.
1,1,2,2,3,3-hexadeuteriobutan-1-ol (CAS 1219794-84-9) is a chemical compound with the molecular formula C4H10O and a molecular weight of 80.16 g/mol. IUPAC name: 1,1,2,2,3,3-hexadeuteriobutan-1-ol. InChIKey: LRHPLDYGYMQRHN-PWDWWLAZSA-N.
| Molecular formula | C4H10O |
|---|---|
| Molecular weight | 80.16 g/mol |
| IUPAC name | 1,1,2,2,3,3-hexadeuteriobutan-1-ol |
| InChIKey | LRHPLDYGYMQRHN-PWDWWLAZSA-N |
| SMILES | [2H]C([2H])(C)C([2H])([2H])C([2H])([2H])O |
Computed by PubChem (NCBI)