Products 25493-17-8
CAS 25493-17-8 appears in our catalog under these names: 1-Butan-d9-ol, n-Butyl-d9 Alcohol, 99 atom % D, min 98% Chemical Purity, 1-BUTAN-D9-OL 98%. Offered by: TRC, CDN, Sigma-Aldrich. Available pack sizes: 100mg, 10mg, 250mg, 1g, 5G.
1,1,2,2,3,3,4,4,4-nonadeuteriobutan-1-ol (CAS 25493-17-8) is a chemical compound with the molecular formula C4H10O and a molecular weight of 83.18 g/mol. IUPAC name: 1,1,2,2,3,3,4,4,4-nonadeuteriobutan-1-ol. InChIKey: LRHPLDYGYMQRHN-YNSOAAEFSA-N.
| Molecular formula | C4H10O |
|---|---|
| Molecular weight | 83.18 g/mol |
| IUPAC name | 1,1,2,2,3,3,4,4,4-nonadeuteriobutan-1-ol |
| InChIKey | LRHPLDYGYMQRHN-YNSOAAEFSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])O |
Computed by PubChem (NCBI)