CAS 1219794-92-9 appears in our catalog under these names: Phosphoric Acid Tripropyl Ester-d21, >95% (HPLC), Tri-n-propyl phosphate D21, Tri-n-propyl-d21 Phosphate, 99 atom % D, min 98% Chemical Purity, Tripropyl phosphate–d21, Tripropyl phosphate-d21, 98.01%. Offered by: TRC, Dr. Ehrenstorfer, CDN, GLPBio, MedChemExpress. Available pack sizes: 100mg, 25mg, 0,5g, 0,25g, 10mg, 5mg, 25 mg, 5 mg.
Tris(1,1,2,2,3,3,3-heptadeuteriopropyl) phosphate (CAS 1219794-92-9) is a chemical compound with the molecular formula C9H21O4P and a molecular weight of 245.36 g/mol. IUPAC name: tris(1,1,2,2,3,3,3-heptadeuteriopropyl) phosphate. InChIKey: RXPQRKFMDQNODS-JPWMFWTESA-N.
| Molecular formula | C9H21O4P |
|---|---|
| Molecular weight | 245.36 g/mol |
| IUPAC name | tris(1,1,2,2,3,3,3-heptadeuteriopropyl) phosphate |
| InChIKey | RXPQRKFMDQNODS-JPWMFWTESA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])OP(=O)(OC([2H])([2H])C([2H])([2H])C([2H])([2H])[2H])OC([2H])([2H])C([2H])([2H])C([2H])([2H])[2H] |
Computed by PubChem (NCBI)