Products 36047-43-5

CAS 36047-43-5 is the registry number for Nonyl dihydrogen phosphate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Nonyl dihydrogen phosphate (CAS 36047-43-5) is a chemical compound with the molecular formula C9H21O4P and a molecular weight of 224.23 g/mol. IUPAC name: nonyl dihydrogen phosphate. InChIKey: WYAKJXQRALMWPB-UHFFFAOYSA-N.

Identity
Molecular formulaC9H21O4P
Molecular weight224.23 g/mol
IUPAC namenonyl dihydrogen phosphate
InChIKeyWYAKJXQRALMWPB-UHFFFAOYSA-N
SMILESCCCCCCCCCOP(=O)(O)O

Computed by PubChem (NCBI)