CAS 1219794-98-5 appears in our catalog under these names: (±)-2-Chloropropionyl-2,3,3,3-d4 Chloride, 98 atom % D, min 97% Chemical Purity, 2-Chloropropionyl chloride-d4. Offered by: CDN, MedChemExpress. Available pack sizes: 0,5g, 1 mg.
2-chloro-2,3,3,3-tetradeuteriopropanoyl chloride (CAS 1219794-98-5) is a chemical compound with the molecular formula C3H4Cl2O and a molecular weight of 130.99 g/mol. IUPAC name: 2-chloro-2,3,3,3-tetradeuteriopropanoyl chloride. InChIKey: JEQDSBVHLKBEIZ-MZCSYVLQSA-N.
| Molecular formula | C3H4Cl2O |
|---|---|
| Molecular weight | 130.99 g/mol |
| IUPAC name | 2-chloro-2,3,3,3-tetradeuteriopropanoyl chloride |
| InChIKey | JEQDSBVHLKBEIZ-MZCSYVLQSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C(=O)Cl)Cl |
Computed by PubChem (NCBI)