Products 350818-52-9

CAS 350818-52-9 is the registry number for 1,3-Dichloroacetone-d4, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 1g, 0,5g.

Structural formula: {0} (CAS {1})

1,3-dichloro-1,1,3,3-tetradeuteriopropan-2-one (CAS 350818-52-9) is a chemical compound with the molecular formula C3H4Cl2O and a molecular weight of 130.99 g/mol. IUPAC name: 1,3-dichloro-1,1,3,3-tetradeuteriopropan-2-one. InChIKey: SUNMBRGCANLOEG-LNLMKGTHSA-N.

Identity
Molecular formulaC3H4Cl2O
Molecular weight130.99 g/mol
IUPAC name1,3-dichloro-1,1,3,3-tetradeuteriopropan-2-one
InChIKeySUNMBRGCANLOEG-LNLMKGTHSA-N
SMILES[2H]C([2H])(C(=O)C([2H])([2H])Cl)Cl

Computed by PubChem (NCBI)