CAS 350818-52-9 is the registry number for 1,3-Dichloroacetone-d4, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 1g, 0,5g.
1,3-dichloro-1,1,3,3-tetradeuteriopropan-2-one (CAS 350818-52-9) is a chemical compound with the molecular formula C3H4Cl2O and a molecular weight of 130.99 g/mol. IUPAC name: 1,3-dichloro-1,1,3,3-tetradeuteriopropan-2-one. InChIKey: SUNMBRGCANLOEG-LNLMKGTHSA-N.
| Molecular formula | C3H4Cl2O |
|---|---|
| Molecular weight | 130.99 g/mol |
| IUPAC name | 1,3-dichloro-1,1,3,3-tetradeuteriopropan-2-one |
| InChIKey | SUNMBRGCANLOEG-LNLMKGTHSA-N |
| SMILES | [2H]C([2H])(C(=O)C([2H])([2H])Cl)Cl |
Computed by PubChem (NCBI)