CAS 1219795-09-1 appears in our catalog under these names: N-(3-Methylbutyryl)glycine-2,2-d2, 98 atom % D, min 98% Chemical Purity, N-Isovaleroylglycine-d2. Offered by: CDN, MedChemExpress. Available pack sizes: 0,05g, 0,01g, 5mg, 1mg.
2,2-dideuterio-2-(3-methylbutanoylamino)acetic acid (CAS 1219795-09-1) is a chemical compound with the molecular formula C7H13NO3 and a molecular weight of 161.20 g/mol. IUPAC name: 2,2-dideuterio-2-(3-methylbutanoylamino)acetic acid. InChIKey: ZRQXMKMBBMNNQC-APZFVMQVSA-N.
| Molecular formula | C7H13NO3 |
|---|---|
| Molecular weight | 161.20 g/mol |
| IUPAC name | 2,2-dideuterio-2-(3-methylbutanoylamino)acetic acid |
| InChIKey | ZRQXMKMBBMNNQC-APZFVMQVSA-N |
| SMILES | [2H]C([2H])(C(=O)O)NC(=O)CC(C)C |
Computed by PubChem (NCBI)