Products 1330037-21-2
CAS 1330037-21-2 appears in our catalog under these names: N-Iso Valerylglycine-d9, >95% (HPLC), N-(3-Methylbutyryl-d9)glycine, 98 atom % D, min 98% Chemical Purity, N–Isovalerylglycine–d9, N-Isovalerylglycine-d9, 99.0%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 1mg, 2,5mg, 5mg, 0,01g, 0,005g, 5 mg, 1 mg.
2-[[2,2,3,4,4,4-hexadeuterio-3-(trideuteriomethyl)butanoyl]amino]acetic acid (CAS 1330037-21-2) is a chemical compound with the molecular formula C7H13NO3 and a molecular weight of 168.24 g/mol. IUPAC name: 2-[[2,2,3,4,4,4-hexadeuterio-3-(trideuteriomethyl)butanoyl]amino]acetic acid. InChIKey: ZRQXMKMBBMNNQC-APXHDBETSA-N.
| Molecular formula | C7H13NO3 |
|---|---|
| Molecular weight | 168.24 g/mol |
| IUPAC name | 2-[[2,2,3,4,4,4-hexadeuterio-3-(trideuteriomethyl)butanoyl]amino]acetic acid |
| InChIKey | ZRQXMKMBBMNNQC-APXHDBETSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])C([2H])([2H])C(=O)NCC(=O)O |
Computed by PubChem (NCBI)