Products 1219795-19-3
CAS 1219795-19-3 appears in our catalog under these names: 2,4'-Dichlorobiphenyl-d8, 98 atom % D, min 98% Chemical Purity, 2,4′-Dichlorobiphenyl-d8. Offered by: CDN, MedChemExpress. Available pack sizes: 0,01g, 1 mg.
1-chloro-2-(4-chloro-2,3,5,6-tetradeuteriophenyl)-3,4,5,6-tetradeuteriobenzene (CAS 1219795-19-3) is a chemical compound with the molecular formula C12H8Cl2 and a molecular weight of 231.14 g/mol. IUPAC name: 1-chloro-2-(4-chloro-2,3,5,6-tetradeuteriophenyl)-3,4,5,6-tetradeuteriobenzene. InChIKey: UFNIBRDIUNVOMX-PGRXLJNUSA-N.
| Molecular formula | C12H8Cl2 |
|---|---|
| Molecular weight | 231.14 g/mol |
| IUPAC name | 1-chloro-2-(4-chloro-2,3,5,6-tetradeuteriophenyl)-3,4,5,6-tetradeuteriobenzene |
| InChIKey | UFNIBRDIUNVOMX-PGRXLJNUSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C2=C(C(=C(C(=C2[2H])[2H])Cl)[2H])[2H])Cl)[2H])[2H] |
Computed by PubChem (NCBI)